C24H19BrFN5O3S — CID 42745891
2-bromo-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 42745891) has the molecular formula C24H19BrFN5O3S and a molecular weight of 556.42 g/mol. Its IUPAC name is 2-bromo-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-bromo-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42745891 |
| Molecular Formula | C24H19BrFN5O3S |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 2-bromo-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1Br)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H19BrFN5O3S/c1-15(27-23(32)20-4-2-3-5-21(20)25)22-28-29-24(35-14-16-6-8-17(26)9-7-16)30(22)18-10-12-19(13-11-18)31(33)34/h2-13,15H,14H2,1H3,(H,27,32) |
| InChIKey | WSYJRPRHEJQYFJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|