C22H24FN5O3S — CID 42745886
N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-methylbutanamide (PubChem CID 42745886) has the molecular formula C22H24FN5O3S and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-methylbutanamide.
| Compound Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 42745886 |
| Molecular Formula | C22H24FN5O3S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(C)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24FN5O3S/c1-14(2)12-20(29)24-15(3)21-25-26-22(32-13-16-4-6-17(23)7-5-16)27(21)18-8-10-19(11-9-18)28(30)31/h4-11,14-15H,12-13H2,1-3H3,(H,24,29) |
| InChIKey | NRPYBRIMVBBWIX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|