C23H20FN5O3S2 — CID 42748658
N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2-thiophen-2-ylacetamide (PubChem CID 42748658) has the molecular formula C23H20FN5O3S2 and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 42748658 |
| Molecular Formula | C23H20FN5O3S2 |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(NC(=O)Cc1cccs1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20FN5O3S2/c1-15(25-21(30)13-20-3-2-12-33-20)22-26-27-23(34-14-16-4-6-17(24)7-5-16)28(22)18-8-10-19(11-9-18)29(31)32/h2-12,15H,13-14H2,1H3,(H,25,30) |
| InChIKey | GOSQHNFDMHJVJN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|