C26H24FN5O5S — CID 42745879
N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,4-dimethoxybenzamide (PubChem CID 42745879) has the molecular formula C26H24FN5O5S and a molecular weight of 537.57 g/mol. Its IUPAC name is N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 42745879 |
| Molecular Formula | C26H24FN5O5S |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2nnc(SCc3ccc(F)cc3)n2-c2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C26H24FN5O5S/c1-16(28-25(33)22-13-12-21(36-2)14-23(22)37-3)24-29-30-26(38-15-17-4-6-18(27)7-5-17)31(24)19-8-10-20(11-9-19)32(34)35/h4-14,16H,15H2,1-3H3,(H,28,33) |
| InChIKey | CXOLYNHEORZWCV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|