C22H23FN6O5S — CID 42748705
ethyl 2-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate (PubChem CID 42748705) has the molecular formula C22H23FN6O5S and a molecular weight of 502.53 g/mol. Its IUPAC name is ethyl 2-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 42748705 |
| Molecular Formula | C22H23FN6O5S |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 2-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NC(C)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23FN6O5S/c1-3-34-19(30)12-24-21(31)25-14(2)20-26-27-22(35-13-15-4-6-16(23)7-5-15)28(20)17-8-10-18(11-9-17)29(32)33/h4-11,14H,3,12-13H2,1-2H3,(H2,24,25,31) |
| InChIKey | KFKDBSRTCOMAKN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|