C26H25N5O5S — CID 42748656
N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,6-dimethoxybenzamide (PubChem CID 42748656) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 42748656 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(C)c1nnc(SCc2ccccc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25N5O5S/c1-17(27-25(32)23-21(35-2)10-7-11-22(23)36-3)24-28-29-26(37-16-18-8-5-4-6-9-18)30(24)19-12-14-20(15-13-19)31(33)34/h4-15,17H,16H2,1-3H3,(H,27,32) |
| InChIKey | HDJRXIIJGNBGTE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|