C32H29N5O5S — CID 42748697
N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,6-dimethoxybenzamide (PubChem CID 42748697) has the molecular formula C32H29N5O5S and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 42748697 |
| Molecular Formula | C32H29N5O5S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(Cc1ccccc1)c1nnc(SCc2ccccc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H29N5O5S/c1-41-27-14-9-15-28(42-2)29(27)31(38)33-26(20-22-10-5-3-6-11-22)30-34-35-32(43-21-23-12-7-4-8-13-23)36(30)24-16-18-25(19-17-24)37(39)40/h3-19,26H,20-21H2,1-2H3,(H,33,38) |
| InChIKey | VUYVJTNRESNEQZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|