C33H32N6O3S — CID 42747035
1-(4-ethylphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]urea (PubChem CID 42747035) has the molecular formula C33H32N6O3S and a molecular weight of 592.73 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 42747035 |
| Molecular Formula | C33H32N6O3S |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]urea |
| SMILES | CCc1ccc(NC(=O)NC(Cc2ccccc2)c2nnc(SCc3cccc(C)c3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C33H32N6O3S/c1-3-24-12-14-27(15-13-24)34-32(40)35-30(21-25-9-5-4-6-10-25)31-36-37-33(43-22-26-11-7-8-23(2)20-26)38(31)28-16-18-29(19-17-28)39(41)42/h4-20,30H,3,21-22H2,1-2H3,(H2,34,35,40) |
| InChIKey | WUTBBFMWQAGXCX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|