C26H26N6O3S2 — CID 4656341
1-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 4656341) has the molecular formula C26H26N6O3S2 and a molecular weight of 534.67 g/mol. Its IUPAC name is 1-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 4656341 |
| Molecular Formula | C26H26N6O3S2 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | CSc1ccc(NC(=O)NC(C)c2nnc(SCc3cccc(C)c3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H26N6O3S2/c1-17-5-4-6-19(15-17)16-37-26-30-29-24(31(26)21-9-11-22(12-10-21)32(34)35)18(2)27-25(33)28-20-7-13-23(36-3)14-8-20/h4-15,18H,16H2,1-3H3,(H2,27,28,33) |
| InChIKey | IVWZPHVKLRHZIR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|