C27H28N6O4S — CID 42746817
1-(4-ethoxyphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]urea (PubChem CID 42746817) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 42746817 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NC(C)c2nnc(SCc3cccc(C)c3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H28N6O4S/c1-4-37-24-14-8-21(9-15-24)29-26(34)28-19(3)25-30-31-27(38-17-20-7-5-6-18(2)16-20)32(25)22-10-12-23(13-11-22)33(35)36/h5-16,19H,4,17H2,1-3H3,(H2,28,29,34) |
| InChIKey | NMZFNJWPWRTUIC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|