C31H27FN6O4S — CID 3892374
1-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-(2-methoxyphenyl)urea (PubChem CID 3892374) has the molecular formula C31H27FN6O4S and a molecular weight of 598.66 g/mol. Its IUPAC name is 1-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 3892374 |
| Molecular Formula | C31H27FN6O4S |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 1-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC(Cc1ccccc1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H27FN6O4S/c1-42-28-10-6-5-9-26(28)33-30(39)34-27(19-21-7-3-2-4-8-21)29-35-36-31(43-20-22-11-13-23(32)14-12-22)37(29)24-15-17-25(18-16-24)38(40)41/h2-18,27H,19-20H2,1H3,(H2,33,34,39) |
| InChIKey | GBBYTLPRBGGHAU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|