C32H26FN5O3S — CID 42746697
(E)-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-phenylprop-2-enamide (PubChem CID 42746697) has the molecular formula C32H26FN5O3S and a molecular weight of 579.66 g/mol. Its IUPAC name is (E)-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42746697 |
| Molecular Formula | C32H26FN5O3S |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | (E)-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(Cc1ccccc1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H26FN5O3S/c33-26-14-11-25(12-15-26)22-42-32-36-35-31(37(32)27-16-18-28(19-17-27)38(40)41)29(21-24-9-5-2-6-10-24)34-30(39)20-13-23-7-3-1-4-8-23/h1-20,29H,21-22H2,(H,34,39)/b20-13+ |
| InChIKey | WKYSXEBTZCLFSF-DEDYPNTBSA-N |
| XLogP | 6.72 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|