C29H24FN5O4S2 — CID 4045549
N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide (PubChem CID 4045549) has the molecular formula C29H24FN5O4S2 and a molecular weight of 589.67 g/mol. Its IUPAC name is N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide.
| Compound Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4045549 |
| Molecular Formula | C29H24FN5O4S2 |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(-n2c(SCc3ccc(F)cc3)nnc2C(Cc2ccccc2)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24FN5O4S2/c30-23-13-11-22(12-14-23)20-40-29-32-31-28(34(29)24-15-17-25(18-16-24)35(36)37)27(19-21-7-3-1-4-8-21)33-41(38,39)26-9-5-2-6-10-26/h1-18,27,33H,19-20H2 |
| InChIKey | ZAWJARKLRCENKH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|