C31H29N5O5S2 — CID 3953971
4-methoxy-N-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide (PubChem CID 3953971) has the molecular formula C31H29N5O5S2 and a molecular weight of 615.74 g/mol. Its IUPAC name is 4-methoxy-N-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3953971 |
| Molecular Formula | C31H29N5O5S2 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | 4-methoxy-N-[1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)c2nnc(SCc3cccc(C)c3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H29N5O5S2/c1-22-7-6-10-24(19-22)21-42-31-33-32-30(35(31)25-11-13-26(14-12-25)36(37)38)29(20-23-8-4-3-5-9-23)34-43(39,40)28-17-15-27(41-2)16-18-28/h3-19,29,34H,20-21H2,1-2H3 |
| InChIKey | ADQUAWJKBFGDCX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|