C18H20N5O2S+ — CID 7123904
[(1R)-1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]azanium (PubChem CID 7123904) has the molecular formula C18H20N5O2S+ and a molecular weight of 370.46 g/mol. Its IUPAC name is [(1R)-1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]azanium.
| Compound Name | [(1R)-1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7123904 |
| Molecular Formula | C18H20N5O2S+ |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [(1R)-1-[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethyl]azanium |
| SMILES | Cc1cccc(CSc2nnc([C@@H](C)[NH3+])n2-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H19N5O2S/c1-12-4-3-5-14(10-12)11-26-18-21-20-17(13(2)19)22(18)15-6-8-16(9-7-15)23(24)25/h3-10,13H,11,19H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | DRYXYRXJHRTFFQ-CYBMUJFWSA-O |
| XLogP | 3.08 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|