C29H22Cl2FN5O4S2 — CID 3950502
2,5-dichloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide (PubChem CID 3950502) has the molecular formula C29H22Cl2FN5O4S2 and a molecular weight of 658.56 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3950502 |
| Molecular Formula | C29H22Cl2FN5O4S2 |
| Molecular Weight | 658.56 g/mol |
| Exact Mass | 657.05 |
| IUPAC Name | 2,5-dichloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(-n2c(SCc3ccc(F)cc3)nnc2C(Cc2ccccc2)NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H22Cl2FN5O4S2/c30-21-8-15-25(31)27(17-21)43(40,41)35-26(16-19-4-2-1-3-5-19)28-33-34-29(42-18-20-6-9-22(32)10-7-20)36(28)23-11-13-24(14-12-23)37(38)39/h1-15,17,26,35H,16,18H2 |
| InChIKey | XDGSLWMTMXTKQP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|