C28H27ClFN5O3S — CID 42746682
3-chloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dimethylpropanamide (PubChem CID 42746682) has the molecular formula C28H27ClFN5O3S and a molecular weight of 568.07 g/mol. Its IUPAC name is 3-chloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42746682 |
| Molecular Formula | C28H27ClFN5O3S |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 3-chloro-N-[1-[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC(Cc1ccccc1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H27ClFN5O3S/c1-28(2,18-29)26(36)31-24(16-19-6-4-3-5-7-19)25-32-33-27(39-17-20-8-10-21(30)11-9-20)34(25)22-12-14-23(15-13-22)35(37)38/h3-15,24H,16-18H2,1-2H3,(H,31,36) |
| InChIKey | PNJSOIYECDNKRX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|