C22H24N6O5S — CID 3294064
ethyl 2-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate (PubChem CID 3294064) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is ethyl 2-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 3294064 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | ethyl 2-[1-[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NC(C)c1nnc(SCc2ccccc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N6O5S/c1-3-33-19(29)13-23-21(30)24-15(2)20-25-26-22(34-14-16-7-5-4-6-8-16)27(20)17-9-11-18(12-10-17)28(31)32/h4-12,15H,3,13-14H2,1-2H3,(H2,23,24,30) |
| InChIKey | CFPCZBIWRWRNFQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|