C22H24N6O6S — CID 3313835
ethyl 2-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methylcarbamoylamino]acetate (PubChem CID 3313835) has the molecular formula C22H24N6O6S and a molecular weight of 500.54 g/mol. Its IUPAC name is ethyl 2-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 3313835 |
| Molecular Formula | C22H24N6O6S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | ethyl 2-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1nnc(SCc2cccc(OC)c2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N6O6S/c1-3-34-20(29)13-24-21(30)23-12-19-25-26-22(35-14-15-5-4-6-18(11-15)33-2)27(19)16-7-9-17(10-8-16)28(31)32/h4-11H,3,12-14H2,1-2H3,(H2,23,24,30) |
| InChIKey | GCMFSRULCVXVSU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|