C28H32N6O4S — CID 4685935
1-(1-adamantyl)-3-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]urea (PubChem CID 4685935) has the molecular formula C28H32N6O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 4685935 |
| Molecular Formula | C28H32N6O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-(1-adamantyl)-3-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]urea |
| SMILES | COc1cccc(CSc2nnc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)n2-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C28H32N6O4S/c1-38-24-4-2-3-18(12-24)17-39-27-32-31-25(33(27)22-5-7-23(8-6-22)34(36)37)16-29-26(35)30-28-13-19-9-20(14-28)11-21(10-19)15-28/h2-8,12,19-21H,9-11,13-17H2,1H3,(H2,29,30,35) |
| InChIKey | JOSVPDCZJUTZHN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|