C23H21N5O3S2 — CID 42750625
N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-thiophen-2-ylacetamide (PubChem CID 42750625) has the molecular formula C23H21N5O3S2 and a molecular weight of 479.59 g/mol. Its IUPAC name is N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 42750625 |
| Molecular Formula | C23H21N5O3S2 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1cccc(CSc2nnc(CNC(=O)Cc3cccs3)n2-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C23H21N5O3S2/c1-16-4-2-5-17(12-16)15-33-23-26-25-21(14-24-22(29)13-20-6-3-11-32-20)27(23)18-7-9-19(10-8-18)28(30)31/h2-12H,13-15H2,1H3,(H,24,29) |
| InChIKey | FTDDHYHSQHKPLT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|