C24H21N5O3S2 — CID 5160038
N-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-phenylsulfanylacetamide (PubChem CID 5160038) has the molecular formula C24H21N5O3S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is N-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 5160038 |
| Molecular Formula | C24H21N5O3S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NCc1nnc(SCc2ccccc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21N5O3S2/c30-23(17-33-21-9-5-2-6-10-21)25-15-22-26-27-24(34-16-18-7-3-1-4-8-18)28(22)19-11-13-20(14-12-19)29(31)32/h1-14H,15-17H2,(H,25,30) |
| InChIKey | VWUKZEJGOPTFQN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|