C26H26N6O3S — CID 4692714
1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 4692714) has the molecular formula C26H26N6O3S and a molecular weight of 502.60 g/mol. Its IUPAC name is 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 4692714 |
| Molecular Formula | C26H26N6O3S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)NCc2nnc(SCc3ccccc3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H26N6O3S/c1-18(2)20-8-10-21(11-9-20)28-25(33)27-16-24-29-30-26(36-17-19-6-4-3-5-7-19)31(24)22-12-14-23(15-13-22)32(34)35/h3-15,18H,16-17H2,1-2H3,(H2,27,28,33) |
| InChIKey | LLFLXYKYMIBFGQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|