C23H19ClN6O3S — CID 42746887
1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(3-chlorophenyl)urea (PubChem CID 42746887) has the molecular formula C23H19ClN6O3S and a molecular weight of 494.96 g/mol. Its IUPAC name is 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 42746887 |
| Molecular Formula | C23H19ClN6O3S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[[5-benzylsulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(NCc1nnc(SCc2ccccc2)n1-c1ccc([N+](=O)[O-])cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19ClN6O3S/c24-17-7-4-8-18(13-17)26-22(31)25-14-21-27-28-23(34-15-16-5-2-1-3-6-16)29(21)19-9-11-20(12-10-19)30(32)33/h1-13H,14-15H2,(H2,25,26,31) |
| InChIKey | DCVHSNLXWRUHIW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|