C30H33N5O3S — CID 3964962
4-hexyl-N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 3964962) has the molecular formula C30H33N5O3S and a molecular weight of 543.69 g/mol. Its IUPAC name is 4-hexyl-N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-hexyl-N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3964962 |
| Molecular Formula | C30H33N5O3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 4-hexyl-N-[[5-[(3-methylphenyl)methylsulfanyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)NCc2nnc(SCc3cccc(C)c3)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H33N5O3S/c1-3-4-5-6-9-23-11-13-25(14-12-23)29(36)31-20-28-32-33-30(39-21-24-10-7-8-22(2)19-24)34(28)26-15-17-27(18-16-26)35(37)38/h7-8,10-19H,3-6,9,20-21H2,1-2H3,(H,31,36) |
| InChIKey | GTPNHRVJZKXFHF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|