C31H36N4O2S — CID 4007113
4-hexyl-N-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 4007113) has the molecular formula C31H36N4O2S and a molecular weight of 528.72 g/mol. Its IUPAC name is 4-hexyl-N-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-hexyl-N-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 4007113 |
| Molecular Formula | C31H36N4O2S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 4-hexyl-N-[[5-[(3-methoxyphenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)NCc2nnc(SCc3cccc(OC)c3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H36N4O2S/c1-4-5-6-7-9-24-14-16-26(17-15-24)30(36)32-21-29-33-34-31(35(29)27-18-12-23(2)13-19-27)38-22-25-10-8-11-28(20-25)37-3/h8,10-20H,4-7,9,21-22H2,1-3H3,(H,32,36) |
| InChIKey | MPMRYROIWNJIRR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|