C28H26F4N4O2S — CID 44913990
4-butoxy-N-[[4-(4-fluorophenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 44913990) has the molecular formula C28H26F4N4O2S and a molecular weight of 558.60 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(4-fluorophenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(4-fluorophenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44913990 |
| Molecular Formula | C28H26F4N4O2S |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 4-butoxy-N-[[4-(4-fluorophenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCc3cccc(C(F)(F)F)c3)n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H26F4N4O2S/c1-2-3-15-38-24-13-7-20(8-14-24)26(37)33-17-25-34-35-27(36(25)23-11-9-22(29)10-12-23)39-18-19-5-4-6-21(16-19)28(30,31)32/h4-14,16H,2-3,15,17-18H2,1H3,(H,33,37) |
| InChIKey | ROIADWATEOWVLI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|