C28H27F3N4O2S — CID 3640271
4-butoxy-N-[[4-phenyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 3640271) has the molecular formula C28H27F3N4O2S and a molecular weight of 540.61 g/mol. Its IUPAC name is 4-butoxy-N-[[4-phenyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-phenyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3640271 |
| Molecular Formula | C28H27F3N4O2S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 4-butoxy-N-[[4-phenyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCc3cccc(C(F)(F)F)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27F3N4O2S/c1-2-3-16-37-24-14-12-21(13-15-24)26(36)32-18-25-33-34-27(35(25)23-10-5-4-6-11-23)38-19-20-8-7-9-22(17-20)28(29,30)31/h4-15,17H,2-3,16,18-19H2,1H3,(H,32,36) |
| InChIKey | OHIIRDMCZZXNQL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|