C28H27BrFN5O3S — CID 44912329
N-[[4-(4-bromophenyl)-5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-butoxybenzamide (PubChem CID 44912329) has the molecular formula C28H27BrFN5O3S and a molecular weight of 612.53 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)-5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-butoxybenzamide.
| Compound Name | N-[[4-(4-bromophenyl)-5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 44912329 |
| Molecular Formula | C28H27BrFN5O3S |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | N-[[4-(4-bromophenyl)-5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3ccc(F)cc3)n2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C28H27BrFN5O3S/c1-2-3-16-38-24-14-4-19(5-15-24)27(37)31-17-25-33-34-28(35(25)23-12-6-20(29)7-13-23)39-18-26(36)32-22-10-8-21(30)9-11-22/h4-15H,2-3,16-18H2,1H3,(H,31,37)(H,32,36) |
| InChIKey | ZYMXBRWYRCLVGF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|