C30H32ClN5O4S — CID 44910898
4-butoxy-N-[[4-(3-chlorophenyl)-5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 44910898) has the molecular formula C30H32ClN5O4S and a molecular weight of 594.14 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(3-chlorophenyl)-5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(3-chlorophenyl)-5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44910898 |
| Molecular Formula | C30H32ClN5O4S |
| Molecular Weight | 594.14 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 4-butoxy-N-[[4-(3-chlorophenyl)-5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3ccc(OCC)cc3)n2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C30H32ClN5O4S/c1-3-5-17-40-26-13-9-21(10-14-26)29(38)32-19-27-34-35-30(36(27)24-8-6-7-22(31)18-24)41-20-28(37)33-23-11-15-25(16-12-23)39-4-2/h6-16,18H,3-5,17,19-20H2,1-2H3,(H,32,38)(H,33,37) |
| InChIKey | VUVYBCOIYYENBW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.14 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|