C32H37N5O4S — CID 44912664
4-butoxy-N-[[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 44912664) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is 4-butoxy-N-[[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44912664 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 4-butoxy-N-[[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3cc(C)ccc3C)n2-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C32H37N5O4S/c1-5-7-18-41-27-14-10-24(11-15-27)31(39)33-20-29-35-36-32(37(29)25-12-16-26(17-13-25)40-6-2)42-21-30(38)34-28-19-22(3)8-9-23(28)4/h8-17,19H,5-7,18,20-21H2,1-4H3,(H,33,39)(H,34,38) |
| InChIKey | UALMXVAADIVFEW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|