C34H41N5O7S — CID 44913136
N-[[4-(2,5-dimethoxyphenyl)-5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 44913136) has the molecular formula C34H41N5O7S and a molecular weight of 663.80 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 44913136 |
| Molecular Formula | C34H41N5O7S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2nnc(SCC(=O)Nc3cc(C)ccc3C)n2-c2cc(OC)ccc2OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C34H41N5O7S/c1-8-44-28-16-23(17-29(45-9-2)32(28)46-10-3)33(41)35-19-30-37-38-34(39(30)26-18-24(42-6)13-14-27(26)43-7)47-20-31(40)36-25-15-21(4)11-12-22(25)5/h11-18H,8-10,19-20H2,1-7H3,(H,35,41)(H,36,40) |
| InChIKey | QVWQTHMXTURPPN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |