C26H29N7O7S2 — CID 44912590
N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 44912590) has the molecular formula C26H29N7O7S2 and a molecular weight of 615.69 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 44912590 |
| Molecular Formula | C26H29N7O7S2 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(OC)c(-n2c(CNC(=O)c3cc(OC)c(OC)c(OC)c3)nnc2SCC(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C26H29N7O7S2/c1-14-29-31-25(42-14)28-22(34)13-41-26-32-30-21(33(26)17-11-16(36-2)7-8-18(17)37-3)12-27-24(35)15-9-19(38-4)23(40-6)20(10-15)39-5/h7-11H,12-13H2,1-6H3,(H,27,35)(H,28,31,34) |
| InChIKey | DTABGYZCSTZBPJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |