C27H30N8O7S3 — CID 4111405
N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 4111405) has the molecular formula C27H30N8O7S3 and a molecular weight of 674.79 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4111405 |
| Molecular Formula | C27H30N8O7S3 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.14 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(OC)c(-n2c(CNC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)nnc2SCC(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C27H30N8O7S3/c1-17-30-32-26(44-17)29-24(36)16-43-27-33-31-23(35(27)21-14-19(40-2)6-9-22(21)41-3)15-28-25(37)18-4-7-20(8-5-18)45(38,39)34-10-12-42-13-11-34/h4-9,14H,10-13,15-16H2,1-3H3,(H,28,37)(H,29,32,36) |
| InChIKey | RFPZDTJLHPNYEW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |