C29H34N8O4S4 — CID 43948366
N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 43948366) has the molecular formula C29H34N8O4S4 and a molecular weight of 686.91 g/mol. Its IUPAC name is N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43948366 |
| Molecular Formula | C29H34N8O4S4 |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3ccc(S(=O)(=O)N4CCCCC4)cc3)n2-c2cc(C)ccc2C)s1 |
| InChI | InChI=1S/C29H34N8O4S4/c1-4-42-29-35-33-27(44-29)31-25(38)18-43-28-34-32-24(37(28)23-16-19(2)8-9-20(23)3)17-30-26(39)21-10-12-22(13-11-21)45(40,41)36-14-6-5-7-15-36/h8-13,16H,4-7,14-15,17-18H2,1-3H3,(H,30,39)(H,31,33,38) |
| InChIKey | OJCFAGMSIWNYDI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|