C24H25N7O2S3 — CID 44911158
N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide (PubChem CID 44911158) has the molecular formula C24H25N7O2S3 and a molecular weight of 539.71 g/mol. Its IUPAC name is N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 44911158 |
| Molecular Formula | C24H25N7O2S3 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethylbenzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3ccc(C)c(C)c3)n2-c2ccccc2)s1 |
| InChI | InChI=1S/C24H25N7O2S3/c1-4-34-24-30-28-22(36-24)26-20(32)14-35-23-29-27-19(31(23)18-8-6-5-7-9-18)13-25-21(33)17-11-10-15(2)16(3)12-17/h5-12H,4,13-14H2,1-3H3,(H,25,33)(H,26,28,32) |
| InChIKey | ZRDAUSNUNMQXHW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|