C26H26F3N7O5S3 — CID 44912269
N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 44912269) has the molecular formula C26H26F3N7O5S3 and a molecular weight of 669.73 g/mol. Its IUPAC name is N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 44912269 |
| Molecular Formula | C26H26F3N7O5S3 |
| Molecular Weight | 669.73 g/mol |
| Exact Mass | 669.11 |
| IUPAC Name | N-[[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3cc(OC)c(OC)c(OC)c3)n2-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C26H26F3N7O5S3/c1-5-42-25-35-33-23(44-25)31-20(37)13-43-24-34-32-19(36(24)16-8-6-7-15(11-16)26(27,28)29)12-30-22(38)14-9-17(39-2)21(41-4)18(10-14)40-3/h6-11H,5,12-13H2,1-4H3,(H,30,38)(H,31,33,37) |
| InChIKey | HKCKPRYHKGQVPU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|