C24H23Cl2N7O5S2 — CID 23881721
N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 23881721) has the molecular formula C24H23Cl2N7O5S2 and a molecular weight of 624.53 g/mol. Its IUPAC name is N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 23881721 |
| Molecular Formula | C24H23Cl2N7O5S2 |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2nnc(SCC(=O)Nc3nnc(C)s3)n2-c2ccc(Cl)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23Cl2N7O5S2/c1-12-29-31-23(40-12)28-20(34)11-39-24-32-30-19(33(24)14-5-6-15(25)16(26)9-14)10-27-22(35)13-7-17(36-2)21(38-4)18(8-13)37-3/h5-9H,10-11H2,1-4H3,(H,27,35)(H,28,31,34) |
| InChIKey | QECVTVUVJBNGKD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |