C20H17Cl2N7O3S3 — CID 3490647
N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide (PubChem CID 3490647) has the molecular formula C20H17Cl2N7O3S3 and a molecular weight of 570.51 g/mol. Its IUPAC name is N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3490647 |
| Molecular Formula | C20H17Cl2N7O3S3 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 568.99 |
| IUPAC Name | N-[[4-(3,4-dichlorophenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3ccco3)n2-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C20H17Cl2N7O3S3/c1-2-33-20-28-26-18(35-20)24-16(30)10-34-19-27-25-15(9-23-17(31)14-4-3-7-32-14)29(19)11-5-6-12(21)13(22)8-11/h3-8H,2,9-10H2,1H3,(H,23,31)(H,24,26,30) |
| InChIKey | AWAZKPUXGVSCHR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|