C24H23ClFN7O2S3 — CID 44912518
2-chloro-N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-6-fluorobenzamide (PubChem CID 44912518) has the molecular formula C24H23ClFN7O2S3 and a molecular weight of 592.15 g/mol. Its IUPAC name is 2-chloro-N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 44912518 |
| Molecular Formula | C24H23ClFN7O2S3 |
| Molecular Weight | 592.15 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | 2-chloro-N-[[4-(2,5-dimethylphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-6-fluorobenzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3c(F)cccc3Cl)n2-c2cc(C)ccc2C)s1 |
| InChI | InChI=1S/C24H23ClFN7O2S3/c1-4-36-24-32-30-22(38-24)28-19(34)12-37-23-31-29-18(33(23)17-10-13(2)8-9-14(17)3)11-27-21(35)20-15(25)6-5-7-16(20)26/h5-10H,4,11-12H2,1-3H3,(H,27,35)(H,28,30,34) |
| InChIKey | ZQQNYYNTUQOMSN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.15 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|