C23H20Cl2N6O2S2 — CID 3430715
2,4-dichloro-N-[[4-(2,5-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 3430715) has the molecular formula C23H20Cl2N6O2S2 and a molecular weight of 547.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-(2,5-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-(2,5-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3430715 |
| Molecular Formula | C23H20Cl2N6O2S2 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 2,4-dichloro-N-[[4-(2,5-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(C)c(-n2c(CNC(=O)c3ccc(Cl)cc3Cl)nnc2SCC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C23H20Cl2N6O2S2/c1-13-3-4-14(2)18(9-13)31-19(11-27-21(33)16-6-5-15(24)10-17(16)25)29-30-23(31)35-12-20(32)28-22-26-7-8-34-22/h3-10H,11-12H2,1-2H3,(H,27,33)(H,26,28,32) |
| InChIKey | IAFXRVXJBIGJJG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |