C25H27N7O5S2 — CID 23847963
N-[[4-(4-ethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide (PubChem CID 23847963) has the molecular formula C25H27N7O5S2 and a molecular weight of 569.67 g/mol. Its IUPAC name is N-[[4-(4-ethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[[4-(4-ethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 23847963 |
| Molecular Formula | C25H27N7O5S2 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | N-[[4-(4-ethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide |
| SMILES | CCOc1ccc(-n2c(CNC(=O)c3cc(OC)cc(OC)c3)nnc2SCC(=O)Nc2nnc(C)s2)cc1 |
| InChI | InChI=1S/C25H27N7O5S2/c1-5-37-18-8-6-17(7-9-18)32-21(13-26-23(34)16-10-19(35-3)12-20(11-16)36-4)29-31-25(32)38-14-22(33)27-24-30-28-15(2)39-24/h6-12H,5,13-14H2,1-4H3,(H,26,34)(H,27,30,33) |
| InChIKey | VGRIGHJEFBEBOR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |