C23H22FN7O4S2 — CID 16815430
N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide (PubChem CID 16815430) has the molecular formula C23H22FN7O4S2 and a molecular weight of 543.61 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 16815430 |
| Molecular Formula | C23H22FN7O4S2 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide |
| SMILES | COc1ccc(OC)c(-n2c(CNC(=O)c3cccc(F)c3)nnc2SCC(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C23H22FN7O4S2/c1-13-27-29-22(37-13)26-20(32)12-36-23-30-28-19(11-25-21(33)14-5-4-6-15(24)9-14)31(23)17-10-16(34-2)7-8-18(17)35-3/h4-10H,11-12H2,1-3H3,(H,25,33)(H,26,29,32) |
| InChIKey | PODYZAPGLLKJRM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |