C25H26N8O6S3 — CID 44912558
N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methyl-3-nitrobenzamide (PubChem CID 44912558) has the molecular formula C25H26N8O6S3 and a molecular weight of 630.73 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 44912558 |
| Molecular Formula | C25H26N8O6S3 |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methyl-3-nitrobenzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(CNC(=O)c3cccc([N+](=O)[O-])c3C)n2-c2cc(OC)ccc2OC)s1 |
| InChI | InChI=1S/C25H26N8O6S3/c1-5-40-25-31-29-23(42-25)27-21(34)13-41-24-30-28-20(32(24)18-11-15(38-3)9-10-19(18)39-4)12-26-22(35)16-7-6-8-17(14(16)2)33(36)37/h6-11H,5,12-13H2,1-4H3,(H,26,35)(H,27,29,34) |
| InChIKey | HCWRPEAIQLHEPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 176.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|