C23H21N7O6S2 — CID 4119349
N-[[4-(2,5-dimethoxyphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide (PubChem CID 4119349) has the molecular formula C23H21N7O6S2 and a molecular weight of 555.60 g/mol. Its IUPAC name is N-[[4-(2,5-dimethoxyphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4119349 |
| Molecular Formula | C23H21N7O6S2 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | N-[[4-(2,5-dimethoxyphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
| SMILES | COc1ccc(OC)c(-n2c(CNC(=O)c3ccc([N+](=O)[O-])cc3)nnc2SCC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C23H21N7O6S2/c1-35-16-7-8-18(36-2)17(11-16)29-19(12-25-21(32)14-3-5-15(6-4-14)30(33)34)27-28-23(29)38-13-20(31)26-22-24-9-10-37-22/h3-11H,12-13H2,1-2H3,(H,25,32)(H,24,26,31) |
| InChIKey | JIWZAWBYFAKQAI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|