C25H22N6O5S — CID 2956137
4-methoxy-N-[[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 2956137) has the molecular formula C25H22N6O5S and a molecular weight of 518.56 g/mol. Its IUPAC name is 4-methoxy-N-[[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-methoxy-N-[[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2956137 |
| Molecular Formula | C25H22N6O5S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 4-methoxy-N-[[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N6O5S/c1-36-21-13-7-17(8-14-21)24(33)26-15-22-28-29-25(30(22)19-5-3-2-4-6-19)37-16-23(32)27-18-9-11-20(12-10-18)31(34)35/h2-14H,15-16H2,1H3,(H,26,33)(H,27,32) |
| InChIKey | NFTZJICERZHMAK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|