C23H19N5O4S — CID 1079547
2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 1079547) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 1079547 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | O=C(CSc1nnc(COc2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C23H19N5O4S/c29-22(24-17-7-3-1-4-8-17)16-33-23-26-25-21(27(23)18-9-5-2-6-10-18)15-32-20-13-11-19(12-14-20)28(30)31/h1-14H,15-16H2,(H,24,29) |
| InChIKey | ICICZALSFFZDQA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|