C18H16N4O5S — CID 1143799
(2R)-2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoic acid (PubChem CID 1143799) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 1143799 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (2R)-2-[[5-[(4-nitrophenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanoic acid |
| SMILES | C[C@@H](Sc1nnc(COc2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H16N4O5S/c1-12(17(23)24)28-18-20-19-16(21(18)13-5-3-2-4-6-13)11-27-15-9-7-14(8-10-15)22(25)26/h2-10,12H,11H2,1H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | IVVDFOIISIAHAA-GFCCVEGCSA-N |
| XLogP | 3.32 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|