C23H22N6O4S — CID 27545708
2-[[4-(4-methoxyphenyl)-5-[(1-methylpyrrol-2-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 27545708) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-5-[(1-methylpyrrol-2-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)-5-[(1-methylpyrrol-2-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27545708 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-5-[(1-methylpyrrol-2-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(-n2c(Cc3cccn3C)nnc2SCC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H22N6O4S/c1-27-13-3-4-19(27)14-21-25-26-23(28(21)17-9-11-20(33-2)12-10-17)34-15-22(30)24-16-5-7-18(8-6-16)29(31)32/h3-13H,14-15H2,1-2H3,(H,24,30) |
| InChIKey | ZQANTXXTIVQCDX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|