C31H27N5O6S — CID 23910678
2-[[5-[(3,4-dimethoxyphenyl)methyl]-4-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 23910678) has the molecular formula C31H27N5O6S and a molecular weight of 597.65 g/mol. Its IUPAC name is 2-[[5-[(3,4-dimethoxyphenyl)methyl]-4-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(3,4-dimethoxyphenyl)methyl]-4-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23910678 |
| Molecular Formula | C31H27N5O6S |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[[5-[(3,4-dimethoxyphenyl)methyl]-4-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(Cc2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)n2-c2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C31H27N5O6S/c1-40-27-17-8-21(18-28(27)41-2)19-29-33-34-31(43-20-30(37)32-22-9-11-24(12-10-22)36(38)39)35(29)23-13-15-26(16-14-23)42-25-6-4-3-5-7-25/h3-18H,19-20H2,1-2H3,(H,32,37) |
| InChIKey | WTKFDEBSXZCBQC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|